|
CAS#: 94201-18-0 Product: 3-(2-Methoxyethylidene)-1,1,5-Trimethylcyclohexane No suppilers available for the product. |
| Name | 3-(2-Methoxyethylidene)-1,1,5-Trimethylcyclohexane |
|---|---|
| Synonyms | (3E)-3-(2-Methoxyethylidene)-1,1,5-Trimethyl-Cyclohexane; 3-(2-Methoxyethylidene)-1,1,5-Trimethylcyclohexane |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O |
| Molecular Weight | 182.31 |
| CAS Registry Number | 94201-18-0 |
| EINECS | 303-601-9 |
| SMILES | C(OC)/C=C1/CC(CC(C1)C)(C)C |
| InChI | 1S/C12H22O/c1-10-7-11(5-6-13-4)9-12(2,3)8-10/h5,10H,6-9H2,1-4H3/b11-5+ |
| InChIKey | UWIFFJDQTKPKGO-VZUCSPMQSA-N |
| Density | 0.89g/cm3 (Cal.) |
|---|---|
| Boiling point | 225.929°C at 760 mmHg (Cal.) |
| Flash point | 76.963°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(2-Methoxyethylidene)-1,1,5-Trimethylcyclohexane |