|
CAS#: 94201-70-4 Product: 5,7,10-Trimethylundec-9-Ene-4,6-Dione No suppilers available for the product. |
| Name | 5,7,10-Trimethylundec-9-Ene-4,6-Dione |
|---|---|
| Synonyms | 9-Undecen-4,6-Dione, 5,7,10-Trimethyl |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 |
| CAS Registry Number | 94201-70-4 |
| EINECS | 303-659-5 |
| SMILES | C(CC(C(C(C(CC=C(C)C)C)=O)C)=O)C |
| InChI | 1S/C14H24O2/c1-6-7-13(15)12(5)14(16)11(4)9-8-10(2)3/h8,11-12H,6-7,9H2,1-5H3 |
| InChIKey | CFGSDQZJQUFHTO-UHFFFAOYSA-N |
| Density | 0.904g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.335°C at 760 mmHg (Cal.) |
| Flash point | 116.085°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,7,10-Trimethylundec-9-Ene-4,6-Dione |