|
CAS#: 94201-69-1 Product: 3,5,8-Trimethylnon-7-Ene-2,4-Dione No suppilers available for the product. |
| Name | 3,5,8-Trimethylnon-7-Ene-2,4-Dione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 |
| CAS Registry Number | 94201-69-1 |
| EINECS | 303-657-4 |
| SMILES | C(C(C(=O)C(C(=O)C)C)C)C=C(C)C |
| InChI | 1S/C12H20O2/c1-8(2)6-7-9(3)12(14)10(4)11(5)13/h6,9-10H,7H2,1-5H3 |
| InChIKey | UQFBGHSPOHCDIM-UHFFFAOYSA-N |
| Density | 0.913g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.7°C at 760 mmHg (Cal.) |
| Flash point | 102.358°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,8-Trimethylnon-7-Ene-2,4-Dione |