|
CAS#: 94201-84-0 Product: 1-(3,4-Dichlorophenyl)-3-[2-(Dimethylamino)Phenyl]Urea No suppilers available for the product. |
| Name | 1-(3,4-Dichlorophenyl)-3-[2-(Dimethylamino)Phenyl]Urea |
|---|---|
| Synonyms | 1-(3,4-Dichlorophenyl)-3-(2-(Dimethylamino)Phenyl)Urea |
| Molecular Structure | ![]() |
| Molecular Formula | C15H15Cl2N3O |
| Molecular Weight | 324.21 |
| CAS Registry Number | 94201-84-0 |
| EINECS | 303-674-7 |
| SMILES | C1=CC=CC(=C1NC(NC2=CC(=C(Cl)C=C2)Cl)=O)N(C)C |
| InChI | 1S/C15H15Cl2N3O/c1-20(2)14-6-4-3-5-13(14)19-15(21)18-10-7-8-11(16)12(17)9-10/h3-9H,1-2H3,(H2,18,19,21) |
| InChIKey | SYJFCLOLWNACOW-UHFFFAOYSA-N |
| Density | 1.399g/cm3 (Cal.) |
|---|---|
| Boiling point | 363.674°C at 760 mmHg (Cal.) |
| Flash point | 173.744°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dichlorophenyl)-3-[2-(Dimethylamino)Phenyl]Urea |