|
CAS#: 94213-42-0 Product: ethyl (2R)-2-amino-2-nitro-3-phenyl-propanoate No suppilers available for the product. |
| Name | ethyl (2R)-2-amino-2-nitro-3-phenyl-propanoate |
|---|---|
| Synonyms | ethyl 2-nitro-3-phenyl-L-alaninate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H14N2O4 |
| Molecular Weight | 238.24 |
| CAS Registry Number | 94213-42-0 |
| EINECS | 303-746-8 |
| SMILES | N[C@](Cc1ccccc1)([N+]([O-])=O)C(=O)OCC |
| InChI | 1S/C11H14N2O4/c1-2-17-10(14)11(12,13(15)16)8-9-6-4-3-5-7-9/h3-7H,2,8,12H2,1H3/t11-/m1/s1 |
| InChIKey | LVYBWCGMATWZRF-LLVKDONJSA-N |
| Density | 1.242g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.524°C at 760 mmHg (Cal.) |
| Flash point | 159.744°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for ethyl (2R)-2-amino-2-nitro-3-phenyl-propanoate |