|
CAS#: 94248-55-2 Product: [(1S,2R,3R)-1-[(1S)-1,2-bis[(2-bromoacetyl)oxy]ethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate No suppilers available for the product. |
| Name | [(1S,2R,3R)-1-[(1S)-1,2-bis[(2-bromoacetyl)oxy]ethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate |
|---|---|
| Synonyms | D-glucitol tris(bromoacetate) |
| Molecular Structure | ![]() |
| Molecular Formula | C12H17Br3O9 |
| Molecular Weight | 544.97 |
| CAS Registry Number | 94248-55-2 |
| EINECS | 304-328-8 |
| SMILES | O[C@@H]([C@H](OC(=O)CBr)[C@H](COC(=O)CBr)OC(=O)CBr)[C@H](O)CO |
| InChI | 1S/C12H17Br3O9/c13-1-8(18)22-5-7(23-9(19)2-14)12(24-10(20)3-15)11(21)6(17)4-16/h6-7,11-12,16-17,21H,1-5H2/t6-,7+,11-,12-/m1/s1 |
| InChIKey | MTLASOOFKUSMEC-HBNNVMOKSA-N |
| Density | 2.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 574.613°C at 760 mmHg (Cal.) |
| Flash point | 301.315°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1S,2R,3R)-1-[(1S)-1,2-bis[(2-bromoacetyl)oxy]ethyl]-2,3,4-trihydroxy-butyl] 2-bromoacetate |