|
CAS#: 94279-14-8 Product: 1-Ethyl-2,3-Bis(1-Phenylethyl)Benzene No suppilers available for the product. |
| Name | 1-Ethyl-2,3-Bis(1-Phenylethyl)Benzene |
|---|---|
| Synonyms | Ethylbis(1-Phenylethyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 94279-14-8 |
| EINECS | 304-760-7 |
| SMILES | C1=CC=C(C(=C1C(C2=CC=CC=C2)C)C(C3=CC=CC=C3)C)CC |
| InChI | 1S/C24H26/c1-4-20-16-11-17-23(18(2)21-12-7-5-8-13-21)24(20)19(3)22-14-9-6-10-15-22/h5-19H,4H2,1-3H3 |
| InChIKey | HHCOXQKOLLRJQZ-UHFFFAOYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.48°C at 760 mmHg (Cal.) |
| Flash point | 202.828°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Ethyl-2,3-Bis(1-Phenylethyl)Benzene |