|
CAS#: 94279-13-7 Product: 1-[1-(3-Ethylphenyl)Ethyl]-2-(1-Phenylethyl)Benzene No suppilers available for the product. |
| Name | 1-[1-(3-Ethylphenyl)Ethyl]-2-(1-Phenylethyl)Benzene |
|---|---|
| Synonyms | (1-(3-Ethylphenyl)Ethyl)(1-Phenylethyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C24H26 |
| Molecular Weight | 314.47 |
| CAS Registry Number | 94279-13-7 |
| EINECS | 304-759-1 |
| SMILES | C3=C(C(C2=C(C(C1=CC=CC=C1)C)C=CC=C2)C)C=CC=C3CC |
| InChI | 1S/C24H26/c1-4-20-11-10-14-22(17-20)19(3)24-16-9-8-15-23(24)18(2)21-12-6-5-7-13-21/h5-19H,4H2,1-3H3 |
| InChIKey | LSJYPNHKZYLVOQ-UHFFFAOYSA-N |
| Density | 0.996g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.308°C at 760 mmHg (Cal.) |
| Flash point | 206.308°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[1-(3-Ethylphenyl)Ethyl]-2-(1-Phenylethyl)Benzene |