|
CAS#: 94538-00-8 Product: 1,3-Dichlorodibenzofuran No suppilers available for the product. |
| Name | 1,3-Dichlorodibenzofuran |
|---|---|
| Synonyms | Dichlorodibenzofuran; Dibenzofuran, Dichloro-; Dibenzofuran, 1,3-Dichloro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H6Cl2O |
| Molecular Weight | 237.08 |
| CAS Registry Number | 94538-00-8 (43047-99-0) |
| SMILES | C1=C2C(=CC=C1)OC3=C2C(=CC(=C3)Cl)Cl |
| InChI | 1S/C12H6Cl2O/c13-7-5-9(14)12-8-3-1-2-4-10(8)15-11(12)6-7/h1-6H |
| InChIKey | VKIBKEFGJSPRJC-UHFFFAOYSA-N |
| Density | 1.442g/cm3 (Cal.) |
|---|---|
| Boiling point | 355.229°C at 760 mmHg (Cal.) |
| Flash point | 168.637°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Dichlorodibenzofuran |