Online Database of Chemicals from Around the World
|
CAS#: 94530-90-2 Product: Guavin B No suppilers available for the product. |
| Name | Guavin B |
|---|---|
| Synonyms | Guavin B |
| Molecular Structure |  |
| Molecular Formula | C33H26O17 |
| Molecular Weight | 694.56 |
| CAS Registry Number | 94530-90-2 |
| SMILES | [C@H]6(O)C3OC(=O)C1=CC(=C(O)C(=C1C2=C(O)C(=C(O)C=C2C(OCC3O[C@@H](OC4=CC(=C(C(=C4)O)C(=O)C5=CC=CC=C5)O)[C@@H]6O)=O)O)O)O |
| InChI | 1S/C33H26O17/c34-15-6-12(7-16(35)22(15)23(38)11-4-2-1-3-5-11)48-33-29(44)28(43)30-19(49-33)10-47-31(45)13-8-17(36)24(39)26(41)20(13)21-14(32(46)50-30)9-18(37)25(40)27(21)42/h1-9,19,28-30,33-37,39-44H,10H2/t19?,28-,29-,30?,33-/m1/s1 |
| InChIKey | RPZNIDVYYGUDPA-JRFUOTGDSA-N |
| Market Analysis Reports |
| List of Reports Available for Guavin B |