|
CAS#: 949-98-4 Product: 2-Methyl-3-(4-nitrophenyl)propenoic acid No suppilers available for the product. |
| Name | 2-Methyl-3-(4-nitrophenyl)propenoic acid |
|---|---|
| Synonyms | (Z)-2-Methyl-3-(4-Nitrophenyl)Acrylic Acid; .Alpha.-Methyl-P-Nitrocinnamic Acid; 2-Propenoic Acid, 2-Methyl-3-(4-Nitrophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 949-98-4 |
| SMILES | C1=CC(=CC=C1\C=C(C(=O)O)\C)[N+]([O-])=O |
| InChI | 1S/C10H9NO4/c1-7(10(12)13)6-8-2-4-9(5-3-8)11(14)15/h2-6H,1H3,(H,12,13)/b7-6- |
| InChIKey | AWWVCUPVXCDDHS-SREVYHEPSA-N |
| Density | 1.352g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.117°C at 760 mmHg (Cal.) |
| Flash point | 151.449°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-(4-nitrophenyl)propenoic acid |