|
CAS#: 952664-97-0 Product: 2-tert-butyl-5-nitro-1H-indole-7-carbonitrile No suppilers available for the product. |
| Name | 2-tert-butyl-5-nitro-1H-indole-7-carbonitrile |
|---|---|
| Synonyms | 2-tert-butyl-5-nitro-1H-indole-7-carbonitrile |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.26 |
| CAS Registry Number | 952664-97-0 |
| SMILES | CC(C)(C)c1cc2cc(cc(c2[nH]1)C#N)[N+](=O)[O-] |
| InChI | 1S/C13H13N3O2/c1-13(2,3)11-6-8-4-10(16(17)18)5-9(7-14)12(8)15-11/h4-6,15H,1-3H3 |
| InChIKey | BSJQIBDHKIHBHB-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.268°C at 760 mmHg (Cal.) |
| Flash point | 209.785°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-tert-butyl-5-nitro-1H-indole-7-carbonitrile |