|
CAS#: 953-22-0 Product: Thiosulfuric acid hydrogen S-[2-(phenethylamino)ethyl] ester No suppilers available for the product. |
| Name | Thiosulfuric acid hydrogen S-[2-(phenethylamino)ethyl] ester |
|---|---|
| Synonyms | 2-[2-(Sulfothio)Ethylamino]Ethylbenzene; Thiosulfuric Acid, S-(2-(Phenethylamino)Ethyl) Ester; Wr 2456 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO3S2 |
| Molecular Weight | 261.35 |
| CAS Registry Number | 953-22-0 |
| SMILES | C1=C(CCNCCS[S](=O)(=O)O)C=CC=C1 |
| InChI | 1S/C10H15NO3S2/c12-16(13,14)15-9-8-11-7-6-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,12,13,14) |
| InChIKey | OPXLJUFZIAHIOA-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Thiosulfuric acid hydrogen S-[2-(phenethylamino)ethyl] ester |