|
CAS#: 95755-29-6 Product: N-tert-Butyloxycarbonyl-Prolyl-Dehydroleucine Methyl Ester No suppilers available for the product. |
| Name | N-tert-Butyloxycarbonyl-Prolyl-Dehydroleucine Methyl Ester |
|---|---|
| Synonyms | Tert-Butyl (2S)-2-[[(Z)-1-Methoxycarbonyl-3-Methyl-But-1-Enyl]Carbamoyl]Pyrrolidine-1-Carboxylate; (2S)-2-[[[(Z)-1-Methoxycarbonyl-3-Methylbut-1-Enyl]Amino]-Oxomethyl]-1-Pyrrolidinecarboxylic Acid Tert-Butyl Ester; (2S)-2-[[(Z)-1-Carbomethoxy-3-Methyl-But-1 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H28N2O5 |
| Molecular Weight | 340.42 |
| CAS Registry Number | 95755-29-6 |
| SMILES | [C@@H]1(N(C(OC(C)(C)C)=O)CCC1)C(=O)NC(/C(OC)=O)=C\C(C)C |
| InChI | 1S/C17H28N2O5/c1-11(2)10-12(15(21)23-6)18-14(20)13-8-7-9-19(13)16(22)24-17(3,4)5/h10-11,13H,7-9H2,1-6H3,(H,18,20)/b12-10-/t13-/m0/s1 |
| InChIKey | QVEZIKLASHMWCG-UKVQZPPCSA-N |
| Density | 1.122g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.742°C at 760 mmHg (Cal.) |
| Flash point | 253.616°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-tert-Butyloxycarbonyl-Prolyl-Dehydroleucine Methyl Ester |