|
CAS#: 957-78-8 Product: 2-Methyl-3-(3-methyl-2-butenyl)-1,4-naphthalenedione No suppilers available for the product. |
| Name | 2-Methyl-3-(3-methyl-2-butenyl)-1,4-naphthalenedione |
|---|---|
| Synonyms | 2-Methyl-3-(3-Methylbut-2-Enyl)-1,4-Naphthoquinone; 1,4-Naphthoquinone, 2-Methyl-3-(3-Methyl-2-Butenyl)-; Lepachol Acetate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H16O2 |
| Molecular Weight | 240.30 |
| CAS Registry Number | 957-78-8 |
| SMILES | C2=C1C(C(=C(C(C1=CC=C2)=O)C)CC=C(C)C)=O |
| InChI | 1S/C16H16O2/c1-10(2)8-9-12-11(3)15(17)13-6-4-5-7-14(13)16(12)18/h4-8H,9H2,1-3H3 |
| InChIKey | ABSPRNADVQNDOU-UHFFFAOYSA-N |
| Density | 1.097g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.774°C at 760 mmHg (Cal.) |
| Flash point | 138.353°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-3-(3-methyl-2-butenyl)-1,4-naphthalenedione |