|
CAS#: 957-82-4 Product: Phenanthren-9-yl acetate No suppilers available for the product. |
| Name | Phenanthren-9-yl acetate |
|---|---|
| Synonyms | 9-Phenanthryl Acetate; Acetic Acid 9-Phenanthryl Ester; Phenanthren-9-Yl Ethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12O2 |
| Molecular Weight | 236.27 |
| CAS Registry Number | 957-82-4 |
| SMILES | C3=CC1=C(C(=CC2=C1C=CC=C2)OC(=O)C)C=C3 |
| InChI | 1S/C16H12O2/c1-11(17)18-16-10-12-6-2-3-7-13(12)14-8-4-5-9-15(14)16/h2-10H,1H3 |
| InChIKey | TZFNHAUIIAFWSB-UHFFFAOYSA-N |
| Density | 1.21g/cm3 (Cal.) |
|---|---|
| Boiling point | 411.217°C at 760 mmHg (Cal.) |
| Flash point | 134.17°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenanthren-9-yl acetate |