|
CAS#: 95832-17-0 Product: 11,14-Dihydroxypregn-4-Ene-3,20-Dione No suppilers available for the product. |
| Name | 11,14-Dihydroxypregn-4-Ene-3,20-Dione |
|---|---|
| Synonyms | (8R,9S,10R,11R,13R,14R,17S)-17-Ethanoyl-11,14-Dihydroxy-10,13-Dimethyl-2,6,7,8,9,11,12,15,16,17-Decahydro-1H-Cyclopenta[A]Phenanthren-3-One; 11,14-Dihydroxypregn-4-Ene-3,20-Dione; Hped |
| Molecular Structure | ![]() |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 |
| CAS Registry Number | 95832-17-0 |
| SMILES | [C@H]23[C@@H]([C@@]1(C(=CC(=O)CC1)CC2)C)[C@H](O)C[C@]4([C@@]3(O)CC[C@@H]4C(=O)C)C |
| InChI | 1S/C21H30O4/c1-12(22)15-7-9-21(25)16-5-4-13-10-14(23)6-8-19(13,2)18(16)17(24)11-20(15,21)3/h10,15-18,24-25H,4-9,11H2,1-3H3/t15-,16-,17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | XVNVIIRMSUKNKJ-CJAFCWQJSA-N |
| Density | 1.22g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.189°C at 760 mmHg (Cal.) |
| Flash point | 283.69°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 11,14-Dihydroxypregn-4-Ene-3,20-Dione |