|
CAS#: 97000-20-9 Product: 3-(3-Hydroxyphenyl)-5-((Methylmercapto)Methyl)-N-N-Propylpiperidine No suppilers available for the product. |
| Name | 3-(3-Hydroxyphenyl)-5-((Methylmercapto)Methyl)-N-N-Propylpiperidine |
|---|---|
| Synonyms | 3-[(3R,5R)-5-(Methylsulfanylmethyl)-1-Propyl-3-Piperidyl]Phenol; 3-[(3R,5R)-5-[(Methylthio)Methyl]-1-Propyl-3-Piperidinyl]Phenol; 3-[(3R,5R)-5-[(Methylthio)Methyl]-1-Propyl-3-Piperidyl]Phenol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H25NOS |
| Molecular Weight | 279.44 |
| CAS Registry Number | 97000-20-9 |
| SMILES | [C@H]1(CN(C[C@@H](C1)CSC)CCC)C2=CC=CC(=C2)O |
| InChI | 1S/C16H25NOS/c1-3-7-17-10-13(12-19-2)8-15(11-17)14-5-4-6-16(18)9-14/h4-6,9,13,15,18H,3,7-8,10-12H2,1-2H3/t13-,15+/m1/s1 |
| InChIKey | SPUJNUMTARGTRY-HIFRSBDPSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 414.881°C at 760 mmHg (Cal.) |
| Flash point | 204.713°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(3-Hydroxyphenyl)-5-((Methylmercapto)Methyl)-N-N-Propylpiperidine |