|
CAS#: 970-06-9 Product: 1,7-Diphenylnaphthalene No suppilers available for the product. |
| Name | 1,7-Diphenylnaphthalene |
|---|---|
| Synonyms | St5440995; 1,7-Diphenylnaphthalene; Naphthalene, 1,7-Diphenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 970-06-9 |
| SMILES | C1=C(C=CC2=CC=CC(=C12)C3=CC=CC=C3)C4=CC=CC=C4 |
| InChI | 1S/C22H16/c1-3-8-17(9-4-1)20-15-14-19-12-7-13-21(22(19)16-20)18-10-5-2-6-11-18/h1-16H |
| InChIKey | GQHLUGQTYDTQDG-UHFFFAOYSA-N |
| Density | 1.103g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.579°C at 760 mmHg (Cal.) |
| Flash point | 216.303°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Diphenylnaphthalene |