|
CAS#: 97042-54-1 Product: 4-Amino-N-(2-Ethyl-6-Propan-2-Yl-Phenyl)Benzamide No suppilers available for the product. |
| Name | 4-Amino-N-(2-Ethyl-6-Propan-2-Yl-Phenyl)Benzamide |
|---|---|
| Synonyms | 4-Amino-N-(2-Ethyl-6-Isopropyl-Phenyl)Benzamide; 4-Amino-N-(2-Ethyl-6-Isopropylphenyl)Benzamide; 4-Amino-N-(2-Ethyl-6-Propan-2-Yl-Phenyl)Benzamide |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.38 |
| CAS Registry Number | 97042-54-1 |
| SMILES | C1=CC=C(C(=C1C(C)C)NC(=O)C2=CC=C(N)C=C2)CC |
| InChI | 1S/C18H22N2O/c1-4-13-6-5-7-16(12(2)3)17(13)20-18(21)14-8-10-15(19)11-9-14/h5-12H,4,19H2,1-3H3,(H,20,21) |
| InChIKey | FPAXDVIXYPASAK-UHFFFAOYSA-N |
| Density | 1.114g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.628°C at 760 mmHg (Cal.) |
| Flash point | 182.788°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-N-(2-Ethyl-6-Propan-2-Yl-Phenyl)Benzamide |