|
CAS#: 97123-83-6 Product: beta-Fluoromethylene-3-Tyrosine No suppilers available for the product. |
| Name | beta-Fluoromethylene-3-Tyrosine |
|---|---|
| Synonyms | Fmmt; Mdl 72394; Mdl-72394 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10FNO3 |
| Molecular Weight | 211.19 |
| CAS Registry Number | 97123-83-6 (99630-95-2) |
| SMILES | [C@H](C(=O)O)(N)\C(C1=CC=CC(=C1)O)=C\F |
| InChI | 1S/C10H10FNO3/c11-5-8(9(12)10(14)15)6-2-1-3-7(13)4-6/h1-5,9,13H,12H2,(H,14,15)/b8-5+/t9-/m0/s1 |
| InChIKey | LAUWCWCSEOWJMQ-QRJSTWQJSA-N |
| Density | 1.382g/cm3 (Cal.) |
|---|---|
| Boiling point | 447.344°C at 760 mmHg (Cal.) |
| Flash point | 224.346°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for beta-Fluoromethylene-3-Tyrosine |