|
CAS#: 97659-29-5 Product: 6-ethyl-3,5-diisopropyl-6-methyl-cyclohex-2-en-1-one No suppilers available for the product. |
| Name | 6-ethyl-3,5-diisopropyl-6-methyl-cyclohex-2-en-1-one |
|---|---|
| Synonyms | 6-ethyl-3,5-bis(isopropyl)-6-methylcyclohexen-1-one |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 |
| CAS Registry Number | 97659-29-5 |
| EINECS | 307-432-1 |
| SMILES | CC(C)C1=CC(=O)C(C)(CC)C(C1)C(C)C |
| InChI | 1S/C15H26O/c1-7-15(6)13(11(4)5)8-12(10(2)3)9-14(15)16/h9-11,13H,7-8H2,1-6H3 |
| InChIKey | HLWXMLWOEOHSJT-UHFFFAOYSA-N |
| Density | 0.874g/cm3 (Cal.) |
|---|---|
| Boiling point | 293.531°C at 760 mmHg (Cal.) |
| Flash point | 127.274°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-ethyl-3,5-diisopropyl-6-methyl-cyclohex-2-en-1-one |