|
CAS#: 98385-67-2 Product: Pyroglutamyl-Leucyl-Tryptophan Methyl Ester No suppilers available for the product. |
| Name | Pyroglutamyl-Leucyl-Tryptophan Methyl Ester |
|---|---|
| Synonyms | (2S)-3-(1H-Indol-3-Yl)-2-[[(2S)-4-Methyl-1-Oxo-2-[[Oxo-[(2S)-5-Oxo-2-Pyrrolidinyl]Methyl]Amino]Pentyl]Amino]Propanoic Acid Methyl Ester; (2S)-3-(1H-Indol-3-Yl)-2-[[(2S)-4-Methyl-2-(Pyroglutamoylamino)Pentanoyl]Amino]Propionic Acid Methyl Ester; Methyl (2S)- |
| Molecular Structure | ![]() |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.51 |
| CAS Registry Number | 98385-67-2 |
| SMILES | [C@@H]1(NC(=O)CC1)C(=O)N[C@H](C(=O)N[C@@H](CC2=C[NH]C3=C2C=CC=C3)C(OC)=O)CC(C)C |
| InChI | 1S/C23H30N4O5/c1-13(2)10-18(26-21(29)17-8-9-20(28)25-17)22(30)27-19(23(31)32-3)11-14-12-24-16-7-5-4-6-15(14)16/h4-7,12-13,17-19,24H,8-11H2,1-3H3,(H,25,28)(H,26,29)(H,27,30)/t17-,18-,19-/m0/s1 |
| InChIKey | JNUHDZHQZHCYSN-FHWLQOOXSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 801.513°C at 760 mmHg (Cal.) |
| Flash point | 438.54°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyroglutamyl-Leucyl-Tryptophan Methyl Ester |