Online Database of Chemicals from Around the World
|
CAS#: 99499-83-9 Product: 3,5,6-Trihydroxy-3',4',7'-Trimethoxyflavone No suppilers available for the product. |
| Name | 3,5,6-Trihydroxy-3',4',7'-Trimethoxyflavone |
|---|---|
| Synonyms | 2-(3,4-Dimethoxyphenyl)-3,5,6-Trihydroxy-7-Methoxy-Chromen-4-One; 2-(3,4-Dimethoxyphenyl)-3,5,6-Trihydroxy-7-Methoxy-4-Chromenone; 2-(3,4-Dimethoxyphenyl)-3,5,6-Trihydroxy-7-Methoxy-Chromone |
| Molecular Structure |  |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.32 |
| CAS Registry Number | 99499-83-9 |
| SMILES | C2=C1OC(=C(O)C(=O)C1=C(O)C(=C2OC)O)C3=CC(=C(OC)C=C3)OC |
| InChI | 1S/C18H16O8/c1-23-9-5-4-8(6-10(9)24-2)18-17(22)16(21)13-11(26-18)7-12(25-3)14(19)15(13)20/h4-7,19-20,22H,1-3H3 |
| InChIKey | CZPFBNZMODZHIK-UHFFFAOYSA-N |
| Density | 1.482g/cm3 (Cal.) |
|---|---|
| Boiling point | 606.744°C at 760 mmHg (Cal.) |
| Flash point | 222.426°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,5,6-Trihydroxy-3',4',7'-Trimethoxyflavone |