|
CAS#: 99820-21-0 Product: Luminamicin No suppilers available for the product. |
| Name | Luminamicin |
|---|---|
| Synonyms | 1,24-Methano-1H,9H,15H-Furo(3',4':10,11)(1,7)Dioxacyclotetradecino(4,3-E)Pyrano(2,3-I)(4)Benzoxecin-6,13,15,18(3Ah)-Tetrone, 4,5,7A,8,16,17,20,20A,24,25,26,26A-Dodecahydro-8,26-Dihydroxy-22,25-Dimethyl-5-Methoxy-; Coloradocin; Luminamicin |
| Molecular Structure | ![]() |
| Molecular Formula | C32H38O12 |
| Molecular Weight | 614.65 |
| CAS Registry Number | 99820-21-0 |
| SMILES | [C@@]13\4O[C@H]2[C@@H]([C@@H](O)[C@@H]1[C@H](C2)C=C[C@@H]3CC(OC)C(O[C@H]6C(/C=C4C)COC(=O)CCC5=C(C(OC5=O)=O)/C=C/OCC6O)=O)C |
| InChI | 1S/C32H38O12/c1-15-10-18-13-41-25(34)7-6-20-21(30(37)43-29(20)36)8-9-40-14-22(33)28(18)42-31(38)24(39-3)12-19-5-4-17-11-23-16(2)27(35)26(17)32(15,19)44-23/h4-5,8-10,16-19,22-24,26-28,33,35H,6-7,11-14H2,1-3H3/b9-8+,15-10+/t16-,17-,18?,19+,22?,23+,24?,26-,2 |
| InChIKey | UGSGHHXIPUAOBJ-FUQUDWCDSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 867.828°C at 760 mmHg (Cal.) |
| Flash point | 280.215°C (Cal.) |
| (1) | Sunazuka Toshiaki, Handa Masaki, Hirose Tomoyasu, Matsumaru Takanori, Togashi Yuko, Nakamura Kaoru, Iwai Yuzuru, Ōmura Satoshi. Synthesis of the oxa-bridged octalin system of two anti-anaerobe antibiotics, luminamicin and lustromycin, Tetrahedron Letters, 2007 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Luminamicin |