| abcr GmbH | Germany | Inquire | ||
|---|---|---|---|---|
![]() |
+49 (721) 950-610 | |||
![]() |
info@abcr.de | |||
| Chemical manufacturer | ||||
| Carbone Scientific Co., Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (870) 486-8629 | |||
![]() |
sales@carbonesci.com | |||
| Chemical distributor | ||||
| Classification | Chemical reagent >> Organic reagent >> Nitro compound |
|---|---|
| Name | N,N-Dimethyl-4-nitroaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C8H10N2O2 |
| Molecular Weight | 166.18 |
| CAS Registry Number | 100-23-2 |
| EC Number | 202-832-1 |
| SMILES | CN(C)C1=CC=C(C=C1)[N+](=O)[O-] |
| Solubility | 9.621e+004 mg/L (25 ºC water) |
|---|---|
| Density | 1.2±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.592, Calc.* |
| Melting point | 182.64 ºC |
| Boiling Point | 287.6±23.0 ºC (760 mmHg), Calc.*, 435.86 ºC |
| Flash Point | 127.7±22.6 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H302-H312-H332 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P270-P271-P280-P301+P317-P302+P352-P304+P340-P317-P321-P330-P362+P364-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for N,N-Dimethyl-4-nitroaniline |