| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (551) 6288-8437 +86 18096409024 | |||
![]() |
info@purerechem.com | |||
![]() |
Skype Chat | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Anilines |
|---|---|
| Name | 3-Chloro-4-(4-pyridinylmethoxy)aniline |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11ClN2O |
| Molecular Weight | 234.68 |
| CAS Registry Number | 105326-69-0 |
| SMILES | c1cc(c(cc1N)Cl)OCc2ccncc2 |
| Solubility | 5972 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.630, Calc.* |
| Melting point | 132.02 ºC |
| Boiling Point | 361.01 ºC, 422.6±35.0 ºC (760 mmHg), Calc.* |
| Flash Point | 209.4±25.9 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-(4-pyridinylmethoxy)aniline |