| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Classification | Organic raw materials >> Nitrile compound |
|---|---|
| Name | 2-(3-(1-Cyanoethyl)-5-methylphenyl)-2-methylpropanenitrile |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 120512-38-1 |
| SMILES | CC1=CC(=CC(=C1)C(C)(C)C#N)C(C)C#N |
| Solubility | 59.99 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.519, Calc.* |
| Melting point | 109.71 ºC |
| Boiling Point | 335.0±32.0 ºC (760 mmHg), Calc.*, 353.85 ºC |
| Flash Point | 147.3±19.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H315-H319-H335 Details |
| Precautionary Statements | P280-P305+P351+P338 Details |
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 2-(3-(1-Cyanoethyl)-5-methylphenyl)-2-methylpropanenitrile |