| Bydone (Shanghai) Biochemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 15826115498 | |||
![]() |
sales@bydonechem.com | |||
![]() |
QQ chat | |||
| Chemical distributor since 2020 | ||||
| chemBlink standard supplier since 2022 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Biphenyl compounds |
|---|---|
| Name | (S)-Methyl 3-([1,1'-biphenyl]-4-yl)-2-((tert-butoxycarbonyl)amino)propanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H25NO4 |
| Molecular Weight | 355.43 |
| CAS Registry Number | 137255-86-8 |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)C(=O)OC |
| Solubility | 0.1894 mg/L (25 ºC water) |
|---|---|
| Density | 1.1±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.538, Calc.* |
| Melting point | 124.76 ºC |
| Boiling Point | 427.85 ºC, 508.6±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 261.4±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319 Details |
| Precautionary Statements | P264-P280-P302+P352-P337+P313-P305+P351+P338-P362+P364-P332+P313 Details |
| Market Analysis Reports |
| List of Reports Available for (S)-Methyl 3-([1,1'-biphenyl]-4-yl)-2-((tert-butoxycarbonyl)amino)propanoate |