| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Analytical chemistry >> Food safety >> Fatty acid, fatty acid methyl ester |
|---|---|
| Name | Phytanic acid |
| Synonyms | 3,7,11,15-tetramethylhexadecanoic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C20H40O2 |
| Molecular Weight | 312.53 |
| CAS Registry Number | 14721-66-5 |
| EC Number | 630-841-4 |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC(C)CC(=O)O |
| Solubility | 0.001092 mg/L (25 ºC water) |
|---|---|
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.454, Calc.* |
| Melting point | 124.61 ºC |
| Boiling Point | 377.27 ºC, 422.3±13.0 ºC (760 mmHg), Calc.* |
| Flash Point | 179.7±11.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H315-H319-H335 Details | ||||||||||||||||||||
| Precautionary Statements | P261-P264-P264+P265-P271-P280-P302+P352-P304+P340-P305+P351+P338-P319-P321-P332+P317-P337+P317-P362+P364-P403+P233-P405-P501 Details | ||||||||||||||||||||
| Hazard Classification | |||||||||||||||||||||
| |||||||||||||||||||||
| SDS | Available | ||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Phytanic acid |