| Cn Chemunion Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.cnchemunion.com | |||
![]() | +86 17366116869 | |||
![]() | david@cnchemunion.com | |||
![]() | QQ Chat | |||
![]() | WeChat: +86 15250069576 | |||
![]() | WhatsApp:+86 17366116869 | |||
| Chemical manufacturer since 2019 | ||||
| chemBlink Standard supplier since 2024 | ||||
| Classification | Pharmaceutical intermediate >> Heterocyclic compound intermediate >> Pyrimidine compound >> Alcohol |
|---|---|
| Name | (S)-3-(4-chlorophenyl)-beta-alaninol HCl |
| Synonyms | (3S)-3-amino-3-(4-chlorophenyl)propan-1-ol;hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13Cl2NO |
| Molecular Weight | 222.11 |
| Protein Sequence | X |
| CAS Registry Number | 1590388-37-6 |
| EC Number | 960-920-1 |
| SMILES | C1=CC(=CC=C1[C@H](CCO)N)Cl.Cl |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P280-P305+P351+P338 Details |
|
(S)-3-(4-chlorophenyl)-beta-alaninol HCl is a chiral organic compound with significant interest in medicinal and pharmaceutical chemistry due to its structural properties and potential biological activity. The compound features a chlorophenyl group attached to a beta-alaninol backbone, which provides both chirality and functional versatility. Its hydrochloride salt form enhances solubility, making it suitable for various applications. The discovery of (S)-3-(4-chlorophenyl)-beta-alaninol HCl is tied to research into the synthesis of beta-amino alcohols, which are commonly used as intermediates in the development of biologically active molecules. This compound's chiral center, specifically in the (S)-configuration, is important because stereochemistry plays a critical role in the interaction of molecules with biological targets. The compound is typically synthesized via asymmetric reduction methods, which ensure the formation of the desired stereoisomer. In pharmaceutical research, (S)-3-(4-chlorophenyl)-beta-alaninol HCl has been investigated for its potential use in the synthesis of drugs that target neurological and cardiovascular systems. Its structure suggests that it may interact with various receptors or enzymes, potentially acting as a precursor or intermediate in drug development. The beta-alaninol portion of the molecule is particularly relevant for modulating neurotransmitter activity, which is important in the treatment of conditions such as anxiety, depression, or hypertension. Moreover, (S)-3-(4-chlorophenyl)-beta-alaninol HCl is valuable as a building block in the design of more complex chemical entities. The presence of both the beta-amino alcohol and the chlorophenyl group allows for further functionalization, making the compound adaptable for use in various synthetic pathways. Its chirality is essential for developing enantiomerically pure compounds, which is a key factor in creating drugs with fewer side effects and enhanced efficacy. In addition to its pharmaceutical applications, this compound has potential uses in materials science, where its chiral and functional groups could contribute to the synthesis of polymers or other materials with specific properties. Its reactivity and stability under different conditions make it a promising candidate for research in both organic synthesis and material development. Overall, (S)-3-(4-chlorophenyl)-beta-alaninol HCl represents a significant compound in medicinal chemistry, with broad potential applications in drug synthesis, biological research, and material science. |
| Market Analysis Reports |