| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (371) 6551-1006 | |||
![]() |
sales@kingorgchem.com | |||
![]() |
QQ chat | |||
![]() |
WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink standard supplier since 2016 | ||||
| Classification | Chemical reagent >> Organic reagent >> Phosphine ligand |
|---|---|
| Name | Di-tert-butyl(cyclohexyl)phosphonium tetrafluoroborate |
| Molecular Structure | ![]() |
| Molecular Formula | C14H30BF4P |
| Molecular Weight | 316.17 |
| CAS Registry Number | 2143022-27-7 |
| SMILES | [B-](F)(F)(F)F.CC(C)(C)[PH+](C1CCCCC1)C(C)(C)C |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H302-H314 Details |
| Precautionary Statements | P501-P260-P270-P264-P280-P303+P361+P353-P301+P330+P331-P363-P301+P312+P330-P304+P340+P310-P305+P351+P338+P310-P405 Details |
| SDS | Available |
|
Di-tert-butyl(cyclohexyl)phosphonium tetrafluoroborate is a specialized chemical compound notable for its role in organophosphorus chemistry and its utility in various industrial and research applications. This substance features a phosphonium cation with two tert-butyl groups and a cyclohexyl group, paired with a tetrafluoroborate anion. The discovery of di-tert-butyl(cyclohexyl)phosphonium tetrafluoroborate arose from the need to develop versatile and stable phosphonium salts for use in catalysis and as ionic liquids. The tert-butyl groups enhance the stability of the phosphonium cation by providing steric protection, while the cyclohexyl group contributes to the overall structure's stability and solubility in different solvents. The tetrafluoroborate anion is known for its high ionic conductivity and minimal reactivity with other chemical species, making it an ideal counterion for various applications. One of the primary applications of di-tert-butyl(cyclohexyl)phosphonium tetrafluoroborate is in the field of catalysis. The compound is used as a ligand or a catalyst in various chemical reactions, including those involving transition metals. Its stability and solubility make it suitable for reactions that require a non-coordinating counterion and high reaction efficiency. In addition to its catalytic uses, this phosphonium salt serves as an ionic liquid. Ionic liquids are salts that remain liquid at room temperature and are known for their unique properties, including low volatility, high thermal stability, and tunable solubility. Di-tert-butyl(cyclohexyl)phosphonium tetrafluoroborate's characteristics make it a candidate for applications such as extraction, separation processes, and as a medium for chemical reactions. The compound's properties also extend its utility to electrochemical applications. Its high ionic conductivity and stability make it suitable for use in batteries and other electrochemical devices where ionic conductors are essential. Overall, di-tert-butyl(cyclohexyl)phosphonium tetrafluoroborate represents an important advancement in the development of phosphonium salts and ionic liquids. Its discovery and subsequent applications highlight its versatility and value in both academic research and industrial processes. |
| Market Analysis Reports |
| List of Reports Available for Di-tert-butyl(cyclohexyl)phosphonium tetrafluoroborate |