| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | Treosulfan |
|---|---|
| Synonyms | [(2S,3S)-2,3-dihydroxy-4-methylsulfonyloxybutyl] methanesulfonate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H14O8S2 |
| Molecular Weight | 278.30 |
| CAS Registry Number | 299-75-2 |
| EC Number | 206-081-0 |
| SMILES | CS(=O)(=O)OC[C@@H]([C@H](COS(=O)(=O)C)O)O |
| Solubility | 1 mg/L (25 ºC water) |
|---|---|
| Density | 1.6±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.518, Calc.* |
| Melting point | 172.08 ºC |
| Boiling Point | 425.90 ºC, 607.0±55.0 ºC (760 mmHg), Calc.* |
| Flash Point | 320.9±31.5 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H350-H371 Details | ||||||||||||||||
| Precautionary Statements | P203-P260-P264-P270-P280-P308+P316-P318-P405-P501 Details | ||||||||||||||||
| Hazard Classification | |||||||||||||||||
| |||||||||||||||||
| SDS | Available | ||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for Treosulfan |