| Shenyang OllyChem Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (24) 6225-9849 +86 13840042106 | |||
![]() |
info@ollychem.com oliverdu@ollychem.com | |||
| Chemical manufacturer since 2001 | ||||
| chemBlink standard supplier since 2007 | ||||
| Simagchem Corporation | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13806087780 | |||
![]() |
sale@simagchem.com | |||
| Chemical manufacturer since 2002 | ||||
| chemBlink standard supplier since 2008 | ||||
| Manus Aktteva | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (79) 6512-3395 | |||
![]() |
products@manusakttevabiopharma.in | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2008 | ||||
| Zhejiang Ausun Pharmaceutical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (576) 8558-9335 +86 13957690608 | |||
![]() |
sales@ausunpharm.com | |||
| Chemical manufacturer since 2011 | ||||
| chemBlink standard supplier since 2009 | ||||
| Changchun BC&HC Pharmaceutical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (431) 8087-1788 8087-1588 +86 15804318207 | |||
![]() |
3468242165@qq.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2014 | ||||
| chemBlink standard supplier since 2016 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Biphenyl compounds |
|---|---|
| Name | [1,1'-Biphenyl]-4-carboxylic acid (3aR,4R,5R,6aS)-4-formylhexahydro-2-oxo-2H-cyclopenta[b]furan-5-yl ester |
| Synonyms | [(3aR,4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] 4-phenylbenzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C21H18O5 |
| Molecular Weight | 350.36 |
| CAS Registry Number | 38754-71-1 |
| SMILES | C1[C@H]2[C@H](CC(=O)O2)[C@H]([C@@H]1OC(=O)C3=CC=C(C=C3)C4=CC=CC=C4)C=O |
| Density | 1.3±0.1 g/cm3, Calc.*, 1.32 |
|---|---|
| Index of Refraction | 1.620, Calc.* |
| Boiling Point | 574.8±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 253.7±30.2 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
|
[1,1'-Biphenyl]-4-carboxylic acid (3aR,4R,5R,6aS)-4-formylhexahydro-2-oxo-2H-cyclopenta[b]furan-5-yl ester is a compound of significant interest in the field of organic chemistry due to its unique structural characteristics and potential applications in medicinal chemistry. The discovery of this compound can be traced back to ongoing efforts to synthesize novel bicyclic compounds with potential bioactive properties. The synthesis of this compound typically involves multi-step organic reactions that include the formation of the biphenyl core, followed by functionalization to introduce the carboxylic acid and furan moieties. The development of this compound is part of a broader effort to explore bicyclic structures that can exhibit biological activity. The specific stereochemistry indicated in its name suggests that this compound could have selective interactions with biological targets, which is crucial for its potential pharmacological applications. One of the primary applications of [1,1'-Biphenyl]-4-carboxylic acid (3aR,4R,5R,6aS)-4-formylhexahydro-2-oxo-2H-cyclopenta[b]furan-5-yl ester is in drug discovery. The unique bicyclic structure may offer improved binding properties to specific enzymes or receptors, making it a candidate for further investigation as a therapeutic agent. Researchers are particularly interested in compounds that can modulate biological pathways related to inflammation, cancer, and other diseases. Furthermore, this compound may serve as an intermediate in the synthesis of more complex molecules. Its structural features make it an attractive building block for the development of larger, more intricate chemical entities. The ability to modify the biphenyl or furan groups could lead to derivatives with enhanced biological activity or selectivity. Research into the properties and applications of [1,1'-Biphenyl]-4-carboxylic acid (3aR,4R,5R,6aS)-4-formylhexahydro-2-oxo-2H-cyclopenta[b]furan-5-yl ester is ongoing. Scientists are exploring its potential as a scaffold for the development of novel pharmaceuticals, utilizing both computational and experimental techniques to assess its biological activity and optimize its pharmacological properties. In summary, [1,1'-Biphenyl]-4-carboxylic acid (3aR,4R,5R,6aS)-4-formylhexahydro-2-oxo-2H-cyclopenta[b]furan-5-yl ester exemplifies the innovative approaches in organic chemistry aimed at developing compounds with significant therapeutic potential. Its unique structure and reactivity offer exciting opportunities for further research and application in drug discovery. References 2015. An Improved and Efficient Process for the Preparation of (+)-cloprostenol. Chirality. DOI: 10.1002/chir.22457 2004. Bimatoprost. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-02-0091 2003. Latanoprost. Pharmaceutical Substances. URL: https://pharmaceutical-substances.thieme.com/ps/search-results?docUri=KD-12-0013 |
| Market Analysis Reports |
| List of Reports Available for [1,1'-Biphenyl]-4-carboxylic acid (3aR,4R,5R,6aS)-4-formylhexahydro-2-oxo-2H-cyclopenta[b]furan-5-yl ester |