| Fenhe Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (021) 3392-6068 | |||
![]() |
julius.wei@fenhechem.com | |||
| Chemical manufacturer since 1997 | ||||
| chemBlink standard supplier since 2024 | ||||
| Classification | Flavors and spices >> Synthetic spice >> Lactone and oxygen-containing heterocyclic compound >> Furan and pyran |
|---|---|
| Name | N-tert-Butyl 4-Nitrophenylsulfonamide |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.29 |
| CAS Registry Number | 49690-09-7 |
| SMILES | CC(C)(C)NS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
| Hazard Symbols |
|
|---|---|
| Hazard Statements | H315-H319-H335 Details |
| Precautionary Statements | P261-P305+P351+P338 Details |
| SDS | Available |
|
N-tert-Butyl 4-Nitrophenylsulfonamide is a notable chemical compound with significant applications in both industrial chemistry and pharmaceutical research. This compound is an example of a sulfonamide derivative, which is known for its diverse chemical properties and biological activities. The discovery of N-tert-Butyl 4-Nitrophenylsulfonamide emerged from research into sulfonamide compounds, which are characterized by the presence of a sulfonamide group attached to an aromatic ring. The specific structure of N-tert-Butyl 4-Nitrophenylsulfonamide features a tert-butyl group, which imparts increased steric bulk, and a nitrophenyl group, which introduces additional electronic effects due to the nitro group. One of the key applications of N-tert-Butyl 4-Nitrophenylsulfonamide is in the field of pharmaceuticals. This compound is used as a reagent in the development of sulfonamide-based drugs. Sulfonamides are a class of compounds with antibacterial properties, and their derivatives are often used to develop new antibiotics. The nitrophenyl group in N-tert-Butyl 4-Nitrophenylsulfonamide can influence the biological activity of the molecule, making it a valuable tool for optimizing drug efficacy and selectivity. In addition to its pharmaceutical applications, N-tert-Butyl 4-Nitrophenylsulfonamide is also employed in industrial chemistry. Its ability to act as a reactive intermediate in various chemical reactions makes it useful in the synthesis of other chemical compounds. For example, it can be used in the preparation of sulfonamide-containing polymers, which have applications in materials science due to their stability and chemical resistance. The compound's distinctive structure, featuring the tert-butyl group and nitrophenyl group, contributes to its reactivity and utility. The tert-butyl group provides steric protection, preventing unwanted side reactions, while the nitro group can enhance the electronic properties of the molecule, influencing its interactions in chemical reactions. Overall, N-tert-Butyl 4-Nitrophenylsulfonamide is a compound of significant interest due to its applications in drug development and industrial synthesis. Its unique chemical structure allows it to play a role in advancing both pharmaceutical research and materials science. As research continues, this compound may contribute to new discoveries and innovations in these fields. |
| Market Analysis Reports |
| List of Reports Available for N-tert-Butyl 4-Nitrophenylsulfonamide |