Online Database of Chemicals from Around the World
| Pure Research Chemicals | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (551) 6288-8437 +86 18096409024 | |||
 |
info@purerechem.com | |||
 |
Skype Chat | |||
 |
QQ chat | |||
 |
WeChat: 18856022585 | |||
| Chemical manufacturer since 2018 | ||||
| Name | 16-epi-Clobetasol |
|---|---|
| Synonyms | (8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-chloroacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| Molecular Structure | ![CAS # 61319-46-8, 16-epi-Clobetasol, (8S,9R,10S,11S,13S,14S,16R,17R)-17-(2-chloroacetyl)-9-fluoro-11,17-dihydroxy-10,13,16-trimethyl-6,7,8,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one](/structures/61319-46-8.gif) |
| Molecular Formula | C22H28ClFO4 |
| Molecular Weight | 410.91 |
| CAS Registry Number | 61319-46-8 |
| SMILES | C[C@@H]1C[C@H]2[C@@H]3CCC4=CC(=O)C=C[C@@]4([C@]3([C@H](C[C@@]2([C@]1(C(=O)CCl)O)C)O)F)C |
| Solubility | 19.97 mg/L (25 ºC water) |
|---|---|
| Density | 1.3±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.582, Calc.* |
| Melting point | 210.98 ºC |
| Boiling Point | 496.55 ºC, 555.1±50.0 ºC (760 mmHg), Calc.* |
| Flash Point | 289.5±30.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for 16-epi-Clobetasol |