| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Biphenyl compounds |
|---|---|
| Name | 3,4'-Diisopropylbiphenyl |
| Synonyms | 1-propan-2-yl-3-(4-propan-2-ylphenyl)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C18H22 |
| Molecular Weight | 238.37 |
| CAS Registry Number | 61434-46-6 |
| SMILES | CC(C)C1=CC=C(C=C1)C2=CC(=CC=C2)C(C)C |
| Solubility | 0.05528 mg/L (25 ºC water) |
|---|---|
| Density | 0.9±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.534, Calc.* |
| Melting point | 76.17 ºC |
| Boiling Point | 340.22 ºC, 336.1±22.0 ºC (760 mmHg), Calc.* |
| Flash Point | 166.0±13.1 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3,4'-Diisopropylbiphenyl |