| R&D Scientific Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (226) 600-0236 | |||
![]() |
sales@rdscientific.com | |||
| Chemical manufacturer since 2016 | ||||
| chemBlink standard supplier since 2023 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Naphthalenes |
|---|---|
| Name | 1,2,3,4-tetrahydro-6-(1-phenylethyl)-Naphthalene |
| Synonyms | 6-(1-phenylethyl)-1,2,3,4-tetrahydronaphthalene |
| Molecular Structure | ![]() |
| Protein Sequence | I |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.35 |
| CAS Registry Number | 6196-98-1 |
| EC Number | 805-293-6 |
| SMILES | CC(C1=CC=CC=C1)C2=CC3=C(CCCC3)C=C2 |
| Solubility | 0.08165 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.575, Calc.* |
| Melting point | 76.97 ºC |
| Boiling Point | 334.80 ºC, 356.2±27.0 ºC (760 mmHg), Calc.* |
| Flash Point | 181.6±14.4 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Symbols |
| ||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| Hazard Statements | H400-H410 Details | ||||||||||||
| Hazard Classification | |||||||||||||
| |||||||||||||
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4-tetrahydro-6-(1-phenylethyl)-Naphthalene |