| Nanjing Finetech Chemical Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 (25) 5207-8417 +86 17714198479 | |||
![]() |
sales@fine-chemtech.com | |||
![]() |
QQ chat | |||
| Chemical manufacturer since 2007 | ||||
| chemBlink standard supplier since 2007 | ||||
| Classification | Organic raw materials >> Aryl compounds >> Anilines |
|---|---|
| Name | 2,6-Dicyclopentylaniline |
| Molecular Structure | ![]() |
| Molecular Formula | C16H23N |
| Molecular Weight | 229.36 |
| CAS Registry Number | 67330-67-0 |
| EC Number | 809-798-2 |
| SMILES | C1CCC(C1)C2=C(C(=CC=C2)C3CCCC3)N |
| Solubility | 0.3939 mg/L (25 ºC water) |
|---|---|
| Density | 1.0±0.0 g/cm3, Calc.* |
| Index of Refraction | 1.582, Calc.* |
| Melting point | 112.90 ºC |
| Boiling Point | 353.30 ºC, 330.6±0.0 ºC (760 mmHg), Calc.* |
| Flash Point | 155.2±0.0 ºC, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Hazard Classification | |||||||||||||||||||||
|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|---|
| |||||||||||||||||||||
| Market Analysis Reports |
| List of Reports Available for 2,6-Dicyclopentylaniline |