|
CAS#: 1130-06-9 Product: Norephedrine Sulfate No suppilers available for the product. |
| Name | Norephedrine Sulfate |
|---|---|
| Synonyms | (2R)-2-Amino-1-Phenyl-Propan-1-Ol; Sulfuric Acid; Norephedrine, Sulfate; Norephedrine, Sulfate (2:1), D-(-)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H15NO5S |
| Molecular Weight | 249.28 |
| CAS Registry Number | 1130-06-9 |
| EINECS | 214-457-0 |
| SMILES | [C@H](N)(C(O)C1=CC=CC=C1)C.O=[S](=O)(O)O |
| InChI | 1S/C9H13NO.H2O4S/c1-7(10)9(11)8-5-3-2-4-6-8;1-5(2,3)4/h2-7,9,11H,10H2,1H3;(H2,1,2,3,4)/t7-,9?;/m1./s1 |
| InChIKey | KBFCMYRZYQVWBJ-DZQWQCQZSA-N |
| Boiling point | 288.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 128.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Norephedrine Sulfate |