|
CAS#: 113035-25-9 Product: 1,3-Bis(Dimethylamino)Cyclopenta[c]Pyrrole-5-Carbaldehyde No suppilers available for the product. |
| Name | 1,3-Bis(Dimethylamino)Cyclopenta[c]Pyrrole-5-Carbaldehyde |
|---|---|
| Synonyms | 1,3-Bis(Dimethylamino)-5-Cyclopenta[C]Pyrrolecarboxaldehyde; 2-Azapentalene, 1,3-Bis(Dimethylamino)-5-Carboxaldehyde- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 |
| CAS Registry Number | 113035-25-9 |
| SMILES | CN(C1=NC(=C2C1=CC(=C2)C=O)N(C)C)C |
| InChI | 1S/C12H15N3O/c1-14(2)11-9-5-8(7-16)6-10(9)12(13-11)15(3)4/h5-7H,1-4H3 |
| InChIKey | BVYFOOLOMFCRML-UHFFFAOYSA-N |
| Density | 1.15g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.511°C at 760 mmHg (Cal.) |
| Flash point | 176.669°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis(Dimethylamino)Cyclopenta[c]Pyrrole-5-Carbaldehyde |