|
CAS#: 128753-82-2 Product: 2a,7b-Dihydro-7b-methoxy-2a-methyl-1,2-dioxeto(3,4-b)benzofuran No suppilers available for the product. |
| Name | 2a,7b-Dihydro-7b-methoxy-2a-methyl-1,2-dioxeto(3,4-b)benzofuran |
|---|---|
| Synonyms | 2A,7B-Dihydro-7B-Methoxy-2A-Methyl-1,2-Dioxeto (3,4-B)Benzofuran; 2A,7B-Dihydro-7B-Methoxy-2A-Methyl-1,2-Dioxeto(3,4-B)Benzofuran; Ccris 4151 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10O4 |
| Molecular Weight | 194.19 |
| CAS Registry Number | 128753-82-2 |
| SMILES | C2=C1C3(C(OC1=CC=C2)(OO3)C)OC |
| InChI | 1S/C10H10O4/c1-9-10(11-2,14-13-9)7-5-3-4-6-8(7)12-9/h3-6H,1-2H3 |
| InChIKey | LWXUSVIZJFTNRN-UHFFFAOYSA-N |
| Density | 1.35g/cm3 (Cal.) |
|---|---|
| Boiling point | 243.383°C at 760 mmHg (Cal.) |
| Flash point | 92.701°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2a,7b-Dihydro-7b-methoxy-2a-methyl-1,2-dioxeto(3,4-b)benzofuran |