|
CAS#: 1505-98-2 Product: alpha-Methyl-alpha-(2-Piperidinoethyl)-1-Naphthaleneacetamide No suppilers available for the product. |
| Name | alpha-Methyl-alpha-(2-Piperidinoethyl)-1-Naphthaleneacetamide |
|---|---|
| Synonyms | 2-Methyl-2-(1-Naphthyl)-4-(1-Piperidyl)Butanamide; 2-Methyl-2-(1-Naphthyl)-4-Piperidino-Butyramide; 2-Methyl-2-Naphthalen-1-Yl-4-Piperidin-1-Yl-Butanamide |
| Molecular Structure | ![]() |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 |
| CAS Registry Number | 1505-98-2 |
| SMILES | C1=C(C2=C(C=C1)C=CC=C2)C(CCN3CCCCC3)(C(N)=O)C |
| InChI | 1S/C20H26N2O/c1-20(19(21)23,12-15-22-13-5-2-6-14-22)18-11-7-9-16-8-3-4-10-17(16)18/h3-4,7-11H,2,5-6,12-15H2,1H3,(H2,21,23) |
| InChIKey | FLHRAPZVGFZSQD-UHFFFAOYSA-N |
| Density | 1.104g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.424°C at 760 mmHg (Cal.) |
| Flash point | 277.01°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for alpha-Methyl-alpha-(2-Piperidinoethyl)-1-Naphthaleneacetamide |