|
CAS#: 16720-01-7 Product: 6,6-Dimethyl-6H-Dibenzo[b,d]Pyran-1,3-Diol No suppilers available for the product. |
| Name | 6,6-Dimethyl-6H-Dibenzo[b,d]Pyran-1,3-Diol |
|---|---|
| Synonyms | 1,3-Dihydroxy-6,6-Dimethyl-6-Dibenzopyran; 5-17-05-00416 (Beilstein Handbook Reference); 6H-Dibenzo(B,D)Pyran-1,3-Diol, 6,6-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 16720-01-7 |
| SMILES | C1=C(O)C=C(O)C2=C1OC(C3=C2C=CC=C3)(C)C |
| InChI | 1S/C15H14O3/c1-15(2)11-6-4-3-5-10(11)14-12(17)7-9(16)8-13(14)18-15/h3-8,16-17H,1-2H3 |
| InChIKey | YWPDGABYTMCJDP-UHFFFAOYSA-N |
| Density | 1.259g/cm3 (Cal.) |
|---|---|
| Boiling point | 454.026°C at 760 mmHg (Cal.) |
| Flash point | 228.387°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,6-Dimethyl-6H-Dibenzo[b,d]Pyran-1,3-Diol |