Online Database of Chemicals from Around the World
|
CAS#: 17107-32-3 Product: 1,6-Dibromo-3-O,4-O-Isopropylidene-1,6-Dideoxy-D-Mannitol No suppilers available for the product. |
| Name | 1,6-Dibromo-3-O,4-O-Isopropylidene-1,6-Dideoxy-D-Mannitol |
|---|---|
| Synonyms | 1,2-Bis(2-Bromo-1-Hydroxy-Ethyl)-3,3-Dimethyl-Cyclopropane-1,2-Diol; Isopropylidene-Dbm; Mannitol, 1,6-Dibromo-1,6-Dideoxy-3,4-Isopropylidene-, (D)- |
| Molecular Structure |  |
| Molecular Formula | C9H16Br2O4 |
| Molecular Weight | 348.03 |
| CAS Registry Number | 17107-32-3 |
| SMILES | C(C(C1(C(C1(C)C)(C(CBr)O)O)O)O)Br |
| InChI | 1S/C9H16Br2O4/c1-7(2)8(14,5(12)3-10)9(7,15)6(13)4-11/h5-6,12-15H,3-4H2,1-2H3 |
| InChIKey | KEOBBYNROASRIK-UHFFFAOYSA-N |
| Density | 1.988g/cm3 (Cal.) |
|---|---|
| Boiling point | 430.5°C at 760 mmHg (Cal.) |
| Flash point | 214.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,6-Dibromo-3-O,4-O-Isopropylidene-1,6-Dideoxy-D-Mannitol |