|
CAS#: 180301-43-3 Product: 2-(1,3-Dimethyl-2,6-Dioxopurin-7-Yl)Ethyl Diethylaminomethanedithioate No suppilers available for the product. |
| Name | 2-(1,3-Dimethyl-2,6-Dioxopurin-7-Yl)Ethyl Diethylaminomethanedithioate |
|---|---|
| Synonyms | 2-(1,3-Dimethyl-2,6-Dioxo-Purin-7-Yl)Ethyl Diethylaminomethanedithioate; Diethylaminomethanedithioic Acid 2-(1,3-Dimethyl-2,6-Dioxo-7-Purinyl)Ethyl Ester; Diethylaminomethanedithioic Acid 2-(2,6-Diketo-1,3-Dimethyl-Purin-7-Yl)Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H21N5O2S2 |
| Molecular Weight | 355.47 |
| CAS Registry Number | 180301-43-3 |
| SMILES | C1=NC2=C([N]1CCSC(N(CC)CC)=S)C(N(C(N2C)=O)C)=O |
| InChI | 1S/C14H21N5O2S2/c1-5-18(6-2)14(22)23-8-7-19-9-15-11-10(19)12(20)17(4)13(21)16(11)3/h9H,5-8H2,1-4H3 |
| InChIKey | WDIRJZXAQSLJGW-UHFFFAOYSA-N |
| Density | 1.351g/cm3 (Cal.) |
|---|---|
| Boiling point | 549.781°C at 760 mmHg (Cal.) |
| Flash point | 286.298°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1,3-Dimethyl-2,6-Dioxopurin-7-Yl)Ethyl Diethylaminomethanedithioate |