|
CAS#: 18264-82-9 Product: 7-Nitro-9,10-Dihydro-2-Phenanthrenamine No suppilers available for the product. |
| Name | 7-Nitro-9,10-Dihydro-2-Phenanthrenamine |
|---|---|
| Synonyms | 2-Phenanthrylamine, 9,10-dihydro-7-nitro-; 7-Nitro-9,10-dihydro-2-phenanthrenamine # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12N2O2 |
| Molecular Weight | 240.26 |
| CAS Registry Number | 18264-82-9 |
| SMILES | [O-][N+](=O)c3ccc2c1c(cc(cc1)N)CCc2c3 |
| InChI | 1S/C14H12N2O2/c15-11-3-5-13-9(7-11)1-2-10-8-12(16(17)18)4-6-14(10)13/h3-8H,1-2,15H2 |
| InChIKey | LDMUNEXHBFAIDA-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.057°C at 760 mmHg (Cal.) |
| Flash point | 233.849°C (Cal.) |
| Refractive index | 1.694 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7-Nitro-9,10-Dihydro-2-Phenanthrenamine |