|
CAS#: 19227-07-7 Product: 2-Phenyl-Azulene No suppilers available for the product. |
| Name | 2-Phenyl-Azulene |
|---|---|
| Synonyms | Azulene, 2-Phenyl-; Azulene,2-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12 |
| Molecular Weight | 204.27 |
| CAS Registry Number | 19227-07-7 |
| SMILES | C3=C(C2=CC1=CC=CC=CC1=C2)C=CC=C3 |
| InChI | 1S/C16H12/c1-3-7-13(8-4-1)16-11-14-9-5-2-6-10-15(14)12-16/h1-12H |
| InChIKey | VUKMMANDBUENJS-UHFFFAOYSA-N |
| Density | 1.082g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.661°C at 760 mmHg (Cal.) |
| Flash point | 165.014°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-Azulene |