|
CAS#: 1936-40-9 Product: 2-Chloro-N,N-Bis(2-Chloroethyl)-1-Propanamine No suppilers available for the product. |
| Name | 2-Chloro-N,N-Bis(2-Chloroethyl)-1-Propanamine |
|---|---|
| Synonyms | Bis(2-Chloroethyl)-(2-Chloropropyl)Amine Hydrochloride; 1-Propylamine, 2-Chloro-N,N-Bis(2-Chloroethyl)-, Hydrochloride; 2-Chloro-N,N-Bis(2-Chloroethyl)-1-Propylamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C7H15Cl4N |
| Molecular Weight | 255.01 |
| CAS Registry Number | 1936-40-9 |
| SMILES | [H+].C(N(CCCl)CCCl)C(Cl)C.[Cl-] |
| InChI | 1S/C7H14Cl3N.ClH/c1-7(10)6-11(4-2-8)5-3-9;/h7H,2-6H2,1H3;1H |
| InChIKey | VNBAOSVONFJBKP-UHFFFAOYSA-N |
| Boiling point | 174°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 59°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-N,N-Bis(2-Chloroethyl)-1-Propanamine |