|
CAS#: 20112-30-5 Product: 17beta-Hydroxy-17-Ethyl-5alpha-Androstane-3-One No suppilers available for the product. |
| Name | 17beta-Hydroxy-17-Ethyl-5alpha-Androstane-3-One |
|---|---|
| Synonyms | 5.Alpha.,17.Alpha.-Pregnan-3-One, 17-Hydroxy-; Nsc18220; Pregnan-3-One, 17-Hydroxy-, (5.Alpha.,17.Alpha.)- |
| Molecular Structure | ![]() |
| Molecular Formula | C21H34O2 |
| Molecular Weight | 318.50 |
| CAS Registry Number | 20112-30-5 |
| SMILES | C(C4(C3(C(C2C(C1(C(CC(=O)CC1)CC2)C)CC3)CC4)C)O)C |
| InChI | 1S/C21H34O2/c1-4-21(23)12-9-18-16-6-5-14-13-15(22)7-10-19(14,2)17(16)8-11-20(18,21)3/h14,16-18,23H,4-13H2,1-3H3 |
| InChIKey | GPUVTXKHQDYRQO-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 429.721°C at 760 mmHg (Cal.) |
| Flash point | 183.322°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 17beta-Hydroxy-17-Ethyl-5alpha-Androstane-3-One |